About (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate;2-methylpropanal
(3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate;2-methylpropanal (PubChem CID 88609454) has the molecular formula C16H32O4
and a molecular weight of 288.43 g/mol. Its IUPAC name is (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate;2-methylpropanal.
Molecular Properties
| Compound Name | (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate;2-methylpropanal |
| PubChem CID | 88609454 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate;2-methylpropanal |
| SMILES | CC(C)C(=O)OCC(C)(C)C(O)C(C)C.CC(C)C=O |
| InChI | InChI=1S/C12H24O3.C4H8O/c1-8(2)10(13)12(5,6)7-15-11(14)9(3)4;1-4(2)3-5/h8-10,13H,7H2,1-6H3;3-4H,1-2H3 |
| InChIKey | CKBVECOMKVRENZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate;2-methylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate;2-methylpropanal?
The IUPAC name of (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate;2-methylpropanal (CID 88609454) is (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate;2-methylpropanal.
What is the SMILES notation for (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate;2-methylpropanal?
The canonical SMILES for (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate;2-methylpropanal is CC(C)C(=O)OCC(C)(C)C(O)C(C)C.CC(C)C=O.
What is the InChIKey of (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate;2-methylpropanal?
The InChIKey is CKBVECOMKVRENZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3.C4H8O/c1-8(2)10(13)12(5,6)7-15-11(14)9(3)4;1-4(2)3-5/h8-10,13H,7H2,1-6H3;3-4H,1-2H3.
What are the key properties of (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate;2-methylpropanal?
(3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate;2-methylpropanal has a molecular weight of 288.43 g/mol, XLogP of 3.07, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate;2-methylpropanal is sourced from PubChem (CID 88609454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).