About bis(dimethylazanium);dioxido(oxo)titanium
bis(dimethylazanium);dioxido(oxo)titanium (PubChem CID 88610005) has the molecular formula C4H16N2O3Ti
and a molecular weight of 188.05 g/mol. Its IUPAC name is bis(dimethylazanium);dioxido(oxo)titanium.
Molecular Properties
| Compound Name | bis(dimethylazanium);dioxido(oxo)titanium |
| PubChem CID | 88610005 |
| Molecular Formula | C4H16N2O3Ti |
| Molecular Weight | 188.05 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | bis(dimethylazanium);dioxido(oxo)titanium |
| SMILES | C[NH2+]C.C[NH2+]C.O=[Ti]([O-])[O-] |
| InChI | InChI=1S/2C2H7N.3O.Ti/c2*1-3-2;;;;/h2*3H,1-2H3;;;;/q;;;2*-1;/p+2 |
| InChIKey | YYQDOSDVIYKDPB-UHFFFAOYSA-P |
| XLogP | -4.88 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.05 |
| LogP ≤ 5 | -4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(dimethylazanium);dioxido(oxo)titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dimethylazanium);dioxido(oxo)titanium?
The IUPAC name of bis(dimethylazanium);dioxido(oxo)titanium (CID 88610005) is bis(dimethylazanium);dioxido(oxo)titanium.
What is the SMILES notation for bis(dimethylazanium);dioxido(oxo)titanium?
The canonical SMILES for bis(dimethylazanium);dioxido(oxo)titanium is C[NH2+]C.C[NH2+]C.O=[Ti]([O-])[O-].
What is the InChIKey of bis(dimethylazanium);dioxido(oxo)titanium?
The InChIKey is YYQDOSDVIYKDPB-UHFFFAOYSA-P. The full InChI is InChI=1S/2C2H7N.3O.Ti/c2*1-3-2;;;;/h2*3H,1-2H3;;;;/q;;;2*-1;/p+2.
What are the key properties of bis(dimethylazanium);dioxido(oxo)titanium?
bis(dimethylazanium);dioxido(oxo)titanium has a molecular weight of 188.05 g/mol, XLogP of -4.88, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dimethylazanium);dioxido(oxo)titanium is sourced from PubChem (CID 88610005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).