C12H12Cl2O — CID 88610396
2,6-bis[(Z)-1-chloroprop-1-en-2-yl]phenol (PubChem CID 88610396) has the molecular formula C12H12Cl2O and a molecular weight of 243.13 g/mol. Its IUPAC name is 2,6-bis[(Z)-1-chloroprop-1-en-2-yl]phenol.
| Compound Name | 2,6-bis[(Z)-1-chloroprop-1-en-2-yl]phenol |
|---|---|
| PubChem CID | 88610396 |
| Molecular Formula | C12H12Cl2O |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 2,6-bis[(Z)-1-chloroprop-1-en-2-yl]phenol |
| SMILES | C/C(=C/Cl)c1cccc(/C(C)=C\Cl)c1O |
| InChI | InChI=1S/C12H12Cl2O/c1-8(6-13)10-4-3-5-11(12(10)15)9(2)7-14/h3-7,15H,1-2H3/b8-6-,9-7- |
| InChIKey | YYSXJLDHWOHZSQ-VRHVFUOLSA-N |
| XLogP | 4.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |