About N,N-diethylethanamine;trifluoromethanesulfonyl chloride
N,N-diethylethanamine;trifluoromethanesulfonyl chloride (PubChem CID 88610578) has the molecular formula C7H15ClF3NO2S
and a molecular weight of 269.72 g/mol. Its IUPAC name is N,N-diethylethanamine;trifluoromethanesulfonyl chloride.
Molecular Properties
| Compound Name | N,N-diethylethanamine;trifluoromethanesulfonyl chloride |
| PubChem CID | 88610578 |
| Molecular Formula | C7H15ClF3NO2S |
| Molecular Weight | 269.72 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | N,N-diethylethanamine;trifluoromethanesulfonyl chloride |
| SMILES | CCN(CC)CC.O=S(=O)(Cl)C(F)(F)F |
| InChI | InChI=1S/C6H15N.CClF3O2S/c1-4-7(5-2)6-3;2-8(6,7)1(3,4)5/h4-6H2,1-3H3; |
| InChIKey | PGVHNXDSBZFXKC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.72 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethylethanamine;trifluoromethanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;trifluoromethanesulfonyl chloride?
The IUPAC name of N,N-diethylethanamine;trifluoromethanesulfonyl chloride (CID 88610578) is N,N-diethylethanamine;trifluoromethanesulfonyl chloride.
What is the SMILES notation for N,N-diethylethanamine;trifluoromethanesulfonyl chloride?
The canonical SMILES for N,N-diethylethanamine;trifluoromethanesulfonyl chloride is CCN(CC)CC.O=S(=O)(Cl)C(F)(F)F.
What is the InChIKey of N,N-diethylethanamine;trifluoromethanesulfonyl chloride?
The InChIKey is PGVHNXDSBZFXKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.CClF3O2S/c1-4-7(5-2)6-3;2-8(6,7)1(3,4)5/h4-6H2,1-3H3;.
What are the key properties of N,N-diethylethanamine;trifluoromethanesulfonyl chloride?
N,N-diethylethanamine;trifluoromethanesulfonyl chloride has a molecular weight of 269.72 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;trifluoromethanesulfonyl chloride is sourced from PubChem (CID 88610578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).