C20H26ClNO — CID 88610945
5-[(1S,2S)-2-(4-chlorophenyl)-2-methylcyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide (PubChem CID 88610945) has the molecular formula C20H26ClNO and a molecular weight of 331.89 g/mol. Its IUPAC name is 5-[(1S,2S)-2-(4-chlorophenyl)-2-methylcyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide.
| Compound Name | 5-[(1S,2S)-2-(4-chlorophenyl)-2-methylcyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 88610945 |
| Molecular Formula | C20H26ClNO |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 5-[(1S,2S)-2-(4-chlorophenyl)-2-methylcyclopropyl]-N-(3-methylbutan-2-yl)penta-2,4-dienamide |
| SMILES | CC(C)C(C)NC(=O)C=CC=C[C@@H]1C[C@]1(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H26ClNO/c1-14(2)15(3)22-19(23)8-6-5-7-17-13-20(17,4)16-9-11-18(21)12-10-16/h5-12,14-15,17H,13H2,1-4H3,(H,22,23)/t15?,17-,20-/m1/s1 |
| InChIKey | MXNBEHADJUYRKX-LQRGHNGLSA-N |
| XLogP | 4.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|