C11H9F5N2O — CID 88611189
5-(1,1,2,2,2-pentafluoroethyl)-4-phenyl-2H-1,3-oxazol-3-amine (PubChem CID 88611189) has the molecular formula C11H9F5N2O and a molecular weight of 280.20 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-4-phenyl-2H-1,3-oxazol-3-amine.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-4-phenyl-2H-1,3-oxazol-3-amine |
|---|---|
| PubChem CID | 88611189 |
| Molecular Formula | C11H9F5N2O |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-4-phenyl-2H-1,3-oxazol-3-amine |
| SMILES | NN1COC(C(F)(F)C(F)(F)F)=C1c1ccccc1 |
| InChI | InChI=1S/C11H9F5N2O/c12-10(13,11(14,15)16)9-8(18(17)6-19-9)7-4-2-1-3-5-7/h1-5H,6,17H2 |
| InChIKey | DYESAHKNFIZIJG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|