C14H41N2O24P8+ — CID 88611202
azane;2,3-diphosphonopent-4-enyl-tris(2,3-diphosphonopropyl)azanium (PubChem CID 88611202) has the molecular formula C14H41N2O24P8+ and a molecular weight of 869.26 g/mol. Its IUPAC name is azane;2,3-diphosphonopent-4-enyl-tris(2,3-diphosphonopropyl)azanium.
| Compound Name | azane;2,3-diphosphonopent-4-enyl-tris(2,3-diphosphonopropyl)azanium |
|---|---|
| PubChem CID | 88611202 |
| Molecular Formula | C14H41N2O24P8+ |
| Molecular Weight | 869.26 g/mol |
| Exact Mass | 868.99 |
| IUPAC Name | azane;2,3-diphosphonopent-4-enyl-tris(2,3-diphosphonopropyl)azanium |
| SMILES | C=CC(C(C[N+](CC(CP(=O)(O)O)P(=O)(O)O)(CC(CP(=O)(O)O)P(=O)(O)O)CC(CP(=O)(O)O)P(=O)(O)O)P(=O)(O)O)P(=O)(O)O.N |
| InChI | InChI=1S/C14H37NO24P8.H3N/c1-2-13(46(34,35)36)14(47(37,38)39)6-15(3-10(43(25,26)27)7-40(16,17)18,4-11(44(28,29)30)8-41(19,20)21)5-12(45(31,32)33)9-42(22,23)24;/h2,10-14H,1,3-9H2,(H15-,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,36,37,38,39);1H3/p+1 |
| InChIKey | MXMHYEGUURRVEB-UHFFFAOYSA-O |
| XLogP | -2.58 |
| TPSA | 495.24 Ų |
| H-Bond Donors | 17 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.26 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 17 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|