C11H16F3NO3S — CID 88611489
4-[[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 88611489) has the molecular formula C11H16F3NO3S and a molecular weight of 299.31 g/mol. Its IUPAC name is 4-[[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 88611489 |
| Molecular Formula | C11H16F3NO3S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4-[[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NC(=O)C(CS)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H16F3NO3S/c12-11(13,14)8(5-19)9(16)15-7-3-1-6(2-4-7)10(17)18/h6-8,19H,1-5H2,(H,15,16)(H,17,18) |
| InChIKey | IVVBWVOHKQWZPF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|