About perchloryl 2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoate
perchloryl 2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoate (PubChem CID 88611917) has the molecular formula C24H23ClN2O6
and a molecular weight of 470.91 g/mol. Its IUPAC name is perchloryl 2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoate.
Molecular Properties
| Compound Name | perchloryl 2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoate |
| PubChem CID | 88611917 |
| Molecular Formula | C24H23ClN2O6 |
| Molecular Weight | 470.91 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | perchloryl 2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoate |
| SMILES | CN(C)c1ccc2c(c1)OC1=CC(N(C)C)C=CC1=C2c1ccccc1C(=O)O[Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H23ClN2O6/c1-26(2)15-9-11-19-21(13-15)32-22-14-16(27(3)4)10-12-20(22)23(19)17-7-5-6-8-18(17)24(28)33-25(29,30)31/h5-15H,1-4H3 |
| InChIKey | FTUIKNCWVXYGJA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.91 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|
Analyze perchloryl 2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of perchloryl 2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoate?
The IUPAC name of perchloryl 2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoate (CID 88611917) is perchloryl 2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoate.
What is the SMILES notation for perchloryl 2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoate?
The canonical SMILES for perchloryl 2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoate is CN(C)c1ccc2c(c1)OC1=CC(N(C)C)C=CC1=C2c1ccccc1C(=O)O[Cl+3]([O-])([O-])[O-].
What is the InChIKey of perchloryl 2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoate?
The InChIKey is FTUIKNCWVXYGJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23ClN2O6/c1-26(2)15-9-11-19-21(13-15)32-22-14-16(27(3)4)10-12-20(22)23(19)17-7-5-6-8-18(17)24(28)33-25(29,30)31/h5-15H,1-4H3.
What are the key properties of perchloryl 2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoate?
perchloryl 2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoate has a molecular weight of 470.91 g/mol, XLogP of 0.38, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for perchloryl 2-[3,6-bis(dimethylamino)-3H-xanthen-9-yl]benzoate is sourced from PubChem (CID 88611917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).