About 1H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride
1H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride (PubChem CID 88612037) has the molecular formula C16H13ClN2
and a molecular weight of 268.75 g/mol. Its IUPAC name is 1H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride.
Molecular Properties
| Compound Name | 1H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride |
| PubChem CID | 88612037 |
| Molecular Formula | C16H13ClN2 |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride |
| SMILES | C1=CCC2=C3C=c4ncccc4=CN3C=CC2=C1.Cl |
| InChI | InChI=1S/C16H12N2.ClH/c1-2-6-14-12(4-1)7-9-18-11-13-5-3-8-17-15(13)10-16(14)18;/h1-5,7-11H,6H2;1H |
| InChIKey | SSTROPATKDLFJQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride?
The IUPAC name of 1H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride (CID 88612037) is 1H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride.
What is the SMILES notation for 1H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride?
The canonical SMILES for 1H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride is C1=CCC2=C3C=c4ncccc4=CN3C=CC2=C1.Cl.
What is the InChIKey of 1H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride?
The InChIKey is SSTROPATKDLFJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2.ClH/c1-2-6-14-12(4-1)7-9-18-11-13-5-3-8-17-15(13)10-16(14)18;/h1-5,7-11H,6H2;1H.
What are the key properties of 1H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride?
1H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride has a molecular weight of 268.75 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride is sourced from PubChem (CID 88612037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).