About 2,4-bis(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid
2,4-bis(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 88612190) has the molecular formula C8H5F6NO2S
and a molecular weight of 293.19 g/mol. Its IUPAC name is 2,4-bis(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid.
Analyze 2,4-bis(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2,4-bis(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid (CID 88612190) is 2,4-bis(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2,4-bis(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2,4-bis(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid is O=C(O)c1sc(CC(F)(F)F)nc1CC(F)(F)F.
What is the InChIKey of 2,4-bis(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is DECOVANOYIJMGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F6NO2S/c9-7(10,11)1-3-5(6(16)17)18-4(15-3)2-8(12,13)14/h1-2H2,(H,16,17).
What are the key properties of 2,4-bis(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid?
2,4-bis(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 293.19 g/mol, XLogP of 3.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(2,2,2-trifluoroethyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 88612190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).