C24H22FN3O3 — CID 88612464
3-(2-fluoroethyl)-5-hydroxy-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 88612464) has the molecular formula C24H22FN3O3 and a molecular weight of 419.46 g/mol. Its IUPAC name is 3-(2-fluoroethyl)-5-hydroxy-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 3-(2-fluoroethyl)-5-hydroxy-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 88612464 |
| Molecular Formula | C24H22FN3O3 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 3-(2-fluoroethyl)-5-hydroxy-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N(C2c3ccccc3CCc3ccccc32)CN1CCF |
| InChI | InChI=1S/C24H22FN3O3/c25-12-14-26-15-28(27-13-11-20(29)23(30)22(27)24(26)31)21-18-7-3-1-5-16(18)9-10-17-6-2-4-8-19(17)21/h1-8,11,13,21,30H,9-10,12,14-15H2 |
| InChIKey | AQNSPFXPMQJBDV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |