About tert-butyl N-(6-amino-5,5-difluoro-4-hydroxy-2-methylhexan-3-yl)carbamate
tert-butyl N-(6-amino-5,5-difluoro-4-hydroxy-2-methylhexan-3-yl)carbamate (PubChem CID 88612782) has the molecular formula C12H24F2N2O3
and a molecular weight of 282.33 g/mol. Its IUPAC name is tert-butyl N-(6-amino-5,5-difluoro-4-hydroxy-2-methylhexan-3-yl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(6-amino-5,5-difluoro-4-hydroxy-2-methylhexan-3-yl)carbamate |
| PubChem CID | 88612782 |
| Molecular Formula | C12H24F2N2O3 |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | tert-butyl N-(6-amino-5,5-difluoro-4-hydroxy-2-methylhexan-3-yl)carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(O)C(F)(F)CN |
| InChI | InChI=1S/C12H24F2N2O3/c1-7(2)8(9(17)12(13,14)6-15)16-10(18)19-11(3,4)5/h7-9,17H,6,15H2,1-5H3,(H,16,18) |
| InChIKey | GIBILCFCRWWPGT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-(6-amino-5,5-difluoro-4-hydroxy-2-methylhexan-3-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(6-amino-5,5-difluoro-4-hydroxy-2-methylhexan-3-yl)carbamate?
The IUPAC name of tert-butyl N-(6-amino-5,5-difluoro-4-hydroxy-2-methylhexan-3-yl)carbamate (CID 88612782) is tert-butyl N-(6-amino-5,5-difluoro-4-hydroxy-2-methylhexan-3-yl)carbamate.
What is the SMILES notation for tert-butyl N-(6-amino-5,5-difluoro-4-hydroxy-2-methylhexan-3-yl)carbamate?
The canonical SMILES for tert-butyl N-(6-amino-5,5-difluoro-4-hydroxy-2-methylhexan-3-yl)carbamate is CC(C)C(NC(=O)OC(C)(C)C)C(O)C(F)(F)CN.
What is the InChIKey of tert-butyl N-(6-amino-5,5-difluoro-4-hydroxy-2-methylhexan-3-yl)carbamate?
The InChIKey is GIBILCFCRWWPGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24F2N2O3/c1-7(2)8(9(17)12(13,14)6-15)16-10(18)19-11(3,4)5/h7-9,17H,6,15H2,1-5H3,(H,16,18).
What are the key properties of tert-butyl N-(6-amino-5,5-difluoro-4-hydroxy-2-methylhexan-3-yl)carbamate?
tert-butyl N-(6-amino-5,5-difluoro-4-hydroxy-2-methylhexan-3-yl)carbamate has a molecular weight of 282.33 g/mol, XLogP of 1.49, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(6-amino-5,5-difluoro-4-hydroxy-2-methylhexan-3-yl)carbamate is sourced from PubChem (CID 88612782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).