About N,N-dimethyl-2-sulfonylethenamine;1-[3-(trifluoromethyl)phenyl]ethanone
N,N-dimethyl-2-sulfonylethenamine;1-[3-(trifluoromethyl)phenyl]ethanone (PubChem CID 88612939) has the molecular formula C13H14F3NO3S
and a molecular weight of 321.32 g/mol. Its IUPAC name is N,N-dimethyl-2-sulfonylethenamine;1-[3-(trifluoromethyl)phenyl]ethanone.
Molecular Properties
| Compound Name | N,N-dimethyl-2-sulfonylethenamine;1-[3-(trifluoromethyl)phenyl]ethanone |
| PubChem CID | 88612939 |
| Molecular Formula | C13H14F3NO3S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N,N-dimethyl-2-sulfonylethenamine;1-[3-(trifluoromethyl)phenyl]ethanone |
| SMILES | CC(=O)c1cccc(C(F)(F)F)c1.CN(C)C=C=S(=O)=O |
| InChI | InChI=1S/C9H7F3O.C4H7NO2S/c1-6(13)7-3-2-4-8(5-7)9(10,11)12;1-5(2)3-4-8(6)7/h2-5H,1H3;3H,1-2H3 |
| InChIKey | SSUCJCHYYHFXPF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-2-sulfonylethenamine;1-[3-(trifluoromethyl)phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-sulfonylethenamine;1-[3-(trifluoromethyl)phenyl]ethanone?
The IUPAC name of N,N-dimethyl-2-sulfonylethenamine;1-[3-(trifluoromethyl)phenyl]ethanone (CID 88612939) is N,N-dimethyl-2-sulfonylethenamine;1-[3-(trifluoromethyl)phenyl]ethanone.
What is the SMILES notation for N,N-dimethyl-2-sulfonylethenamine;1-[3-(trifluoromethyl)phenyl]ethanone?
The canonical SMILES for N,N-dimethyl-2-sulfonylethenamine;1-[3-(trifluoromethyl)phenyl]ethanone is CC(=O)c1cccc(C(F)(F)F)c1.CN(C)C=C=S(=O)=O.
What is the InChIKey of N,N-dimethyl-2-sulfonylethenamine;1-[3-(trifluoromethyl)phenyl]ethanone?
The InChIKey is SSUCJCHYYHFXPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3O.C4H7NO2S/c1-6(13)7-3-2-4-8(5-7)9(10,11)12;1-5(2)3-4-8(6)7/h2-5H,1H3;3H,1-2H3.
What are the key properties of N,N-dimethyl-2-sulfonylethenamine;1-[3-(trifluoromethyl)phenyl]ethanone?
N,N-dimethyl-2-sulfonylethenamine;1-[3-(trifluoromethyl)phenyl]ethanone has a molecular weight of 321.32 g/mol, XLogP of 2.25, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-sulfonylethenamine;1-[3-(trifluoromethyl)phenyl]ethanone is sourced from PubChem (CID 88612939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).