About dioxovanadium;3-(hydroperoxymethyl)pentane
dioxovanadium;3-(hydroperoxymethyl)pentane (PubChem CID 88612947) has the molecular formula C6H14O4V
and a molecular weight of 201.12 g/mol. Its IUPAC name is dioxovanadium;3-(hydroperoxymethyl)pentane.
Molecular Properties
| Compound Name | dioxovanadium;3-(hydroperoxymethyl)pentane |
| PubChem CID | 88612947 |
| Molecular Formula | C6H14O4V |
| Molecular Weight | 201.12 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | dioxovanadium;3-(hydroperoxymethyl)pentane |
| SMILES | CCC(CC)COO.O=[V]=O |
| InChI | InChI=1S/C6H14O2.2O.V/c1-3-6(4-2)5-8-7;;;/h6-7H,3-5H2,1-2H3;;; |
| InChIKey | OOHVYJNGIIFWTK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.12 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze dioxovanadium;3-(hydroperoxymethyl)pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxovanadium;3-(hydroperoxymethyl)pentane?
The IUPAC name of dioxovanadium;3-(hydroperoxymethyl)pentane (CID 88612947) is dioxovanadium;3-(hydroperoxymethyl)pentane.
What is the SMILES notation for dioxovanadium;3-(hydroperoxymethyl)pentane?
The canonical SMILES for dioxovanadium;3-(hydroperoxymethyl)pentane is CCC(CC)COO.O=[V]=O.
What is the InChIKey of dioxovanadium;3-(hydroperoxymethyl)pentane?
The InChIKey is OOHVYJNGIIFWTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.2O.V/c1-3-6(4-2)5-8-7;;;/h6-7H,3-5H2,1-2H3;;;.
What are the key properties of dioxovanadium;3-(hydroperoxymethyl)pentane?
dioxovanadium;3-(hydroperoxymethyl)pentane has a molecular weight of 201.12 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioxovanadium;3-(hydroperoxymethyl)pentane is sourced from PubChem (CID 88612947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).