C27H42ClNO2 — CID 88613914
1-ethoxyethyl-dimethyl-(2,2,4,4-tetramethyl-1-phenoxy-1-phenylpentyl)azanium chloride (PubChem CID 88613914) has the molecular formula C27H42ClNO2 and a molecular weight of 448.09 g/mol. Its IUPAC name is 1-ethoxyethyl-dimethyl-(2,2,4,4-tetramethyl-1-phenoxy-1-phenylpentyl)azanium chloride.
| Compound Name | 1-ethoxyethyl-dimethyl-(2,2,4,4-tetramethyl-1-phenoxy-1-phenylpentyl)azanium chloride |
|---|---|
| PubChem CID | 88613914 |
| Molecular Formula | C27H42ClNO2 |
| Molecular Weight | 448.09 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | 1-ethoxyethyl-dimethyl-(2,2,4,4-tetramethyl-1-phenoxy-1-phenylpentyl)azanium chloride |
| SMILES | CCOC(C)[N+](C)(C)C(Oc1ccccc1)(c1ccccc1)C(C)(C)CC(C)(C)C.[Cl-] |
| InChI | InChI=1S/C27H42NO2.ClH/c1-10-29-22(2)28(8,9)27(23-17-13-11-14-18-23,26(6,7)21-25(3,4)5)30-24-19-15-12-16-20-24;/h11-20,22H,10,21H2,1-9H3;1H/q+1;/p-1 |
| InChIKey | IRNFBTDOSOMNHY-UHFFFAOYSA-M |
| XLogP | 3.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.09 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|