About 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]phenol;carbonic acid
2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]phenol;carbonic acid (PubChem CID 88613916) has the molecular formula C27H38O5
and a molecular weight of 442.60 g/mol. Its IUPAC name is 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]phenol;carbonic acid.
Molecular Properties
| Compound Name | 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]phenol;carbonic acid |
| PubChem CID | 88613916 |
| Molecular Formula | C27H38O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]phenol;carbonic acid |
| SMILES | CC(C)(C)c1cc(C2(c3ccc(O)c(C(C)(C)C)c3)CCCCC2)ccc1O.O=C(O)O |
| InChI | InChI=1S/C26H36O2.CH2O3/c1-24(2,3)20-16-18(10-12-22(20)27)26(14-8-7-9-15-26)19-11-13-23(28)21(17-19)25(4,5)6;2-1(3)4/h10-13,16-17,27-28H,7-9,14-15H2,1-6H3;(H2,2,3,4) |
| InChIKey | RCECITFGOAMAKJ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]phenol;carbonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]phenol;carbonic acid?
The IUPAC name of 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]phenol;carbonic acid (CID 88613916) is 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]phenol;carbonic acid.
What is the SMILES notation for 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]phenol;carbonic acid?
The canonical SMILES for 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]phenol;carbonic acid is CC(C)(C)c1cc(C2(c3ccc(O)c(C(C)(C)C)c3)CCCCC2)ccc1O.O=C(O)O.
What is the InChIKey of 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]phenol;carbonic acid?
The InChIKey is RCECITFGOAMAKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H36O2.CH2O3/c1-24(2,3)20-16-18(10-12-22(20)27)26(14-8-7-9-15-26)19-11-13-23(28)21(17-19)25(4,5)6;2-1(3)4/h10-13,16-17,27-28H,7-9,14-15H2,1-6H3;(H2,2,3,4).
What are the key properties of 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]phenol;carbonic acid?
2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]phenol;carbonic acid has a molecular weight of 442.60 g/mol, XLogP of 7.17, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]phenol;carbonic acid is sourced from PubChem (CID 88613916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).