About butanediimidamide;dihydrochloride
butanediimidamide;dihydrochloride (PubChem CID 88614640) has the molecular formula C4H12Cl2N4
and a molecular weight of 187.07 g/mol. Its IUPAC name is butanediimidamide;dihydrochloride.
Molecular Properties
| Compound Name | butanediimidamide;dihydrochloride |
| PubChem CID | 88614640 |
| Molecular Formula | C4H12Cl2N4 |
| Molecular Weight | 187.07 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | butanediimidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)CC/C(N)=N/[H] |
| InChI | InChI=1S/C4H10N4.2ClH/c5-3(6)1-2-4(7)8;;/h1-2H2,(H3,5,6)(H3,7,8);2*1H |
| InChIKey | KNKQRQIMHLJAER-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.07 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze butanediimidamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanediimidamide;dihydrochloride?
The IUPAC name of butanediimidamide;dihydrochloride (CID 88614640) is butanediimidamide;dihydrochloride.
What is the SMILES notation for butanediimidamide;dihydrochloride?
The canonical SMILES for butanediimidamide;dihydrochloride is Cl.Cl.[H]/N=C(\N)CC/C(N)=N/[H].
What is the InChIKey of butanediimidamide;dihydrochloride?
The InChIKey is KNKQRQIMHLJAER-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N4.2ClH/c5-3(6)1-2-4(7)8;;/h1-2H2,(H3,5,6)(H3,7,8);2*1H.
What are the key properties of butanediimidamide;dihydrochloride?
butanediimidamide;dihydrochloride has a molecular weight of 187.07 g/mol, XLogP of 0.48, 3 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanediimidamide;dihydrochloride is sourced from PubChem (CID 88614640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).