C22H24F12O4 — CID 88614845
bis(2-cyclohexyl-1,1,1,3,3,3-hexafluoropropan-2-yl) (E)-but-2-enedioate (PubChem CID 88614845) has the molecular formula C22H24F12O4 and a molecular weight of 580.41 g/mol. Its IUPAC name is bis(2-cyclohexyl-1,1,1,3,3,3-hexafluoropropan-2-yl) (E)-but-2-enedioate.
| Compound Name | bis(2-cyclohexyl-1,1,1,3,3,3-hexafluoropropan-2-yl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 88614845 |
| Molecular Formula | C22H24F12O4 |
| Molecular Weight | 580.41 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | bis(2-cyclohexyl-1,1,1,3,3,3-hexafluoropropan-2-yl) (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)OC(C1CCCCC1)(C(F)(F)F)C(F)(F)F)OC(C1CCCCC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H24F12O4/c23-19(24,25)17(20(26,27)28,13-7-3-1-4-8-13)37-15(35)11-12-16(36)38-18(21(29,30)31,22(32,33)34)14-9-5-2-6-10-14/h11-14H,1-10H2/b12-11+ |
| InChIKey | ICZOUPYBVJFWAZ-VAWYXSNFSA-N |
| XLogP | 7.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.41 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|