C22H24N6O7S2 — CID 88615164
O-[(2R,3S,5R)-2-(6-benzamidopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 1,1-dioxo-1,4-thiazinane-4-carbothioate (PubChem CID 88615164) has the molecular formula C22H24N6O7S2 and a molecular weight of 548.60 g/mol. Its IUPAC name is O-[(2R,3S,5R)-2-(6-benzamidopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 1,1-dioxo-1,4-thiazinane-4-carbothioate.
| Compound Name | O-[(2R,3S,5R)-2-(6-benzamidopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 1,1-dioxo-1,4-thiazinane-4-carbothioate |
|---|---|
| PubChem CID | 88615164 |
| Molecular Formula | C22H24N6O7S2 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | O-[(2R,3S,5R)-2-(6-benzamidopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 1,1-dioxo-1,4-thiazinane-4-carbothioate |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)C(O)[C@@H]1OC(=S)N1CCS(=O)(=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H24N6O7S2/c29-10-14-16(30)17(35-22(36)27-6-8-37(32,33)9-7-27)21(34-14)28-12-25-15-18(23-11-24-19(15)28)26-20(31)13-4-2-1-3-5-13/h1-5,11-12,14,16-17,21,29-30H,6-10H2,(H,23,24,26,31)/t14-,16?,17+,21-/m1/s1 |
| InChIKey | CEPHSBSFECQPBD-SCSFDUGFSA-N |
| XLogP | -0.27 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|