About methyl 3-amino-3-methyliminopropanoate;hydrochloride
methyl 3-amino-3-methyliminopropanoate;hydrochloride (PubChem CID 88616016) has the molecular formula C5H11ClN2O2
and a molecular weight of 166.61 g/mol. Its IUPAC name is methyl 3-amino-3-methyliminopropanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 3-amino-3-methyliminopropanoate;hydrochloride |
| PubChem CID | 88616016 |
| Molecular Formula | C5H11ClN2O2 |
| Molecular Weight | 166.61 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | methyl 3-amino-3-methyliminopropanoate;hydrochloride |
| SMILES | C/N=C(\N)CC(=O)OC.Cl |
| InChI | InChI=1S/C5H10N2O2.ClH/c1-7-4(6)3-5(8)9-2;/h3H2,1-2H3,(H2,6,7);1H |
| InChIKey | KHHFANKQMGNKMX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.61 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-amino-3-methyliminopropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-3-methyliminopropanoate;hydrochloride?
The IUPAC name of methyl 3-amino-3-methyliminopropanoate;hydrochloride (CID 88616016) is methyl 3-amino-3-methyliminopropanoate;hydrochloride.
What is the SMILES notation for methyl 3-amino-3-methyliminopropanoate;hydrochloride?
The canonical SMILES for methyl 3-amino-3-methyliminopropanoate;hydrochloride is C/N=C(\N)CC(=O)OC.Cl.
What is the InChIKey of methyl 3-amino-3-methyliminopropanoate;hydrochloride?
The InChIKey is KHHFANKQMGNKMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2.ClH/c1-7-4(6)3-5(8)9-2;/h3H2,1-2H3,(H2,6,7);1H.
What are the key properties of methyl 3-amino-3-methyliminopropanoate;hydrochloride?
methyl 3-amino-3-methyliminopropanoate;hydrochloride has a molecular weight of 166.61 g/mol, XLogP of -0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-3-methyliminopropanoate;hydrochloride is sourced from PubChem (CID 88616016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).