C13H16Cl3N — CID 88616184
11,12,13-Trichloro-11-azatricyclo[7.4.1.05,14]tetradeca-1(14),12-diene (PubChem CID 88616184) has the molecular formula C13H16Cl3N and a molecular weight of 292.60 g/mol. Its IUPAC name is 11,12,13-trichloro-11-azatricyclo[7.4.1.05,14]tetradeca-1(14),12-diene.
| Compound Name | 11,12,13-Trichloro-11-azatricyclo[7.4.1.05,14]tetradeca-1(14),12-diene |
|---|---|
| PubChem CID | 88616184 |
| Molecular Formula | C13H16Cl3N |
| Molecular Weight | 292.60 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 11,12,13-trichloro-11-azatricyclo[7.4.1.05,14]tetradeca-1(14),12-diene |
| SMILES | C1CC2CCCC3=C2C(C1)CN(C(=C3Cl)Cl)Cl |
| InChI | InChI=1S/C13H16Cl3N/c14-12-10-6-2-4-8-3-1-5-9(11(8)10)7-17(16)13(12)15/h8-9H,1-7H2 |
| InChIKey | FSJRGLJOXGFISN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 3.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | 399 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|