C21H20ClN5O2 — CID 88616374
6-(7-chloro-1,8-naphthyridin-2-yl)-7-(5-methyl-2-oxohexyl)-7H-pyrrolo[3,4-b]pyrazin-5-one (PubChem CID 88616374) has the molecular formula C21H20ClN5O2 and a molecular weight of 409.88 g/mol. Its IUPAC name is 6-(7-chloro-1,8-naphthyridin-2-yl)-7-(5-methyl-2-oxohexyl)-7H-pyrrolo[3,4-b]pyrazin-5-one.
| Compound Name | 6-(7-chloro-1,8-naphthyridin-2-yl)-7-(5-methyl-2-oxohexyl)-7H-pyrrolo[3,4-b]pyrazin-5-one |
|---|---|
| PubChem CID | 88616374 |
| Molecular Formula | C21H20ClN5O2 |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 6-(7-chloro-1,8-naphthyridin-2-yl)-7-(5-methyl-2-oxohexyl)-7H-pyrrolo[3,4-b]pyrazin-5-one |
| SMILES | CC(C)CCC(=O)CC1c2nccnc2C(=O)N1c1ccc2ccc(Cl)nc2n1 |
| InChI | InChI=1S/C21H20ClN5O2/c1-12(2)3-6-14(28)11-15-18-19(24-10-9-23-18)21(29)27(15)17-8-5-13-4-7-16(22)25-20(13)26-17/h4-5,7-10,12,15H,3,6,11H2,1-2H3 |
| InChIKey | KBHIUTAYBPNRIL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 88.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|