C12H11NO — CID 88616385
5-ethyl-4-oxa-2-azatricyclo[6.4.0.03,5]dodeca-1(12),2,6,8,10-pentaene (PubChem CID 88616385) has the molecular formula C12H11NO and a molecular weight of 185.23 g/mol. Its IUPAC name is 5-ethyl-4-oxa-2-azatricyclo[6.4.0.03,5]dodeca-1(12),2,6,8,10-pentaene.
| Compound Name | 5-ethyl-4-oxa-2-azatricyclo[6.4.0.03,5]dodeca-1(12),2,6,8,10-pentaene |
|---|---|
| PubChem CID | 88616385 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 5-ethyl-4-oxa-2-azatricyclo[6.4.0.03,5]dodeca-1(12),2,6,8,10-pentaene |
| SMILES | CCC12C=Cc3ccccc3N=C1O2 |
| InChI | InChI=1S/C12H11NO/c1-2-12-8-7-9-5-3-4-6-10(9)13-11(12)14-12/h3-8H,2H2,1H3 |
| InChIKey | QKPHSJSOTPDHFW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 24.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|