C20H29NO4 — CID 88616719
acetic acid;(1S,9S,10S,17S)-4-methoxy-17-methyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 88616719) has the molecular formula C20H29NO4 and a molecular weight of 347.45 g/mol. Its IUPAC name is acetic acid;(1S,9S,10S,17S)-4-methoxy-17-methyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | acetic acid;(1S,9S,10S,17S)-4-methoxy-17-methyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 88616719 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | acetic acid;(1S,9S,10S,17S)-4-methoxy-17-methyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | CC(=O)O.COc1ccc2c(c1)[C@]13CCCC[C@@H]1[C@H](C2)[N@@+](C)([O-])CC3 |
| InChI | InChI=1S/C18H25NO2.C2H4O2/c1-19(20)10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(21-2)12-16(13)18;1-2(3)4/h6-7,12,15,17H,3-5,8-11H2,1-2H3;1H3,(H,3,4)/t15-,17+,18+,19+;/m1./s1 |
| InChIKey | AETHJBYWFZYVMO-QNXWSWPKSA-N |
| XLogP | 3.49 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|