C16H26O2 — CID 88616788
(4E,10E)-13-methyl-1-oxacyclohexadeca-4,10-dien-2-one (PubChem CID 88616788) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (4E,10E)-13-methyl-1-oxacyclohexadeca-4,10-dien-2-one.
| Compound Name | (4E,10E)-13-methyl-1-oxacyclohexadeca-4,10-dien-2-one |
|---|---|
| PubChem CID | 88616788 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (4E,10E)-13-methyl-1-oxacyclohexadeca-4,10-dien-2-one |
| SMILES | CC1C/C=C/CCCC/C=C/CC(=O)OCCC1 |
| InChI | InChI=1S/C16H26O2/c1-15-11-8-6-4-2-3-5-7-9-13-16(17)18-14-10-12-15/h6-9,15H,2-5,10-14H2,1H3/b8-6+,9-7+ |
| InChIKey | UIERNLMCLNWNGZ-CDJQDVQCSA-N |
| XLogP | 4.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|