About 1-O-butyl 4-O-(2-cyanopropan-2-yl) butanedioate
1-O-butyl 4-O-(2-cyanopropan-2-yl) butanedioate (PubChem CID 88616798) has the molecular formula C12H19NO4
and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-O-butyl 4-O-(2-cyanopropan-2-yl) butanedioate.
Molecular Properties
| Compound Name | 1-O-butyl 4-O-(2-cyanopropan-2-yl) butanedioate |
| PubChem CID | 88616798 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 1-O-butyl 4-O-(2-cyanopropan-2-yl) butanedioate |
| SMILES | CCCCOC(=O)CCC(=O)OC(C)(C)C#N |
| InChI | InChI=1S/C12H19NO4/c1-4-5-8-16-10(14)6-7-11(15)17-12(2,3)9-13/h4-8H2,1-3H3 |
| InChIKey | JDKQBWWAJZQEQI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-O-butyl 4-O-(2-cyanopropan-2-yl) butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-butyl 4-O-(2-cyanopropan-2-yl) butanedioate?
The IUPAC name of 1-O-butyl 4-O-(2-cyanopropan-2-yl) butanedioate (CID 88616798) is 1-O-butyl 4-O-(2-cyanopropan-2-yl) butanedioate.
What is the SMILES notation for 1-O-butyl 4-O-(2-cyanopropan-2-yl) butanedioate?
The canonical SMILES for 1-O-butyl 4-O-(2-cyanopropan-2-yl) butanedioate is CCCCOC(=O)CCC(=O)OC(C)(C)C#N.
What is the InChIKey of 1-O-butyl 4-O-(2-cyanopropan-2-yl) butanedioate?
The InChIKey is JDKQBWWAJZQEQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO4/c1-4-5-8-16-10(14)6-7-11(15)17-12(2,3)9-13/h4-8H2,1-3H3.
What are the key properties of 1-O-butyl 4-O-(2-cyanopropan-2-yl) butanedioate?
1-O-butyl 4-O-(2-cyanopropan-2-yl) butanedioate has a molecular weight of 241.29 g/mol, XLogP of 1.96, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-butyl 4-O-(2-cyanopropan-2-yl) butanedioate is sourced from PubChem (CID 88616798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).