C11H12ClF6NO4 — CID 88617038
[(2S,3R,4S,6S)-6-chloro-2-methyl-4-[[(2,2,2-trifluoroacetyl)amino]methyl]oxan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 88617038) has the molecular formula C11H12ClF6NO4 and a molecular weight of 371.66 g/mol. Its IUPAC name is [(2S,3R,4S,6S)-6-chloro-2-methyl-4-[[(2,2,2-trifluoroacetyl)amino]methyl]oxan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2S,3R,4S,6S)-6-chloro-2-methyl-4-[[(2,2,2-trifluoroacetyl)amino]methyl]oxan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 88617038 |
| Molecular Formula | C11H12ClF6NO4 |
| Molecular Weight | 371.66 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | [(2S,3R,4S,6S)-6-chloro-2-methyl-4-[[(2,2,2-trifluoroacetyl)amino]methyl]oxan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | C[C@@H]1O[C@@H](Cl)C[C@@H](CNC(=O)C(F)(F)F)[C@H]1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H12ClF6NO4/c1-4-7(23-9(21)11(16,17)18)5(2-6(12)22-4)3-19-8(20)10(13,14)15/h4-7H,2-3H2,1H3,(H,19,20)/t4-,5-,6+,7-/m0/s1 |
| InChIKey | MYEKJXAFVDRZPP-YTLHQDLWSA-N |
| XLogP | 2.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.66 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|