C12H10Cl2F8O4 — CID 88617184
(Z)-2-chloro-1-ethoxy-4,4,5,5,5-pentafluoropent-1-en-3-one;(Z)-3-chloro-1,1,1-trifluoro-4-methoxybut-3-en-2-one (PubChem CID 88617184) has the molecular formula C12H10Cl2F8O4 and a molecular weight of 441.10 g/mol. Its IUPAC name is (Z)-2-chloro-1-ethoxy-4,4,5,5,5-pentafluoropent-1-en-3-one;(Z)-3-chloro-1,1,1-trifluoro-4-methoxybut-3-en-2-one.
| Compound Name | (Z)-2-chloro-1-ethoxy-4,4,5,5,5-pentafluoropent-1-en-3-one;(Z)-3-chloro-1,1,1-trifluoro-4-methoxybut-3-en-2-one |
|---|---|
| PubChem CID | 88617184 |
| Molecular Formula | C12H10Cl2F8O4 |
| Molecular Weight | 441.10 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | (Z)-2-chloro-1-ethoxy-4,4,5,5,5-pentafluoropent-1-en-3-one;(Z)-3-chloro-1,1,1-trifluoro-4-methoxybut-3-en-2-one |
| SMILES | CCO/C=C(\Cl)C(=O)C(F)(F)C(F)(F)F.CO/C=C(\Cl)C(=O)C(F)(F)F |
| InChI | InChI=1S/C7H6ClF5O2.C5H4ClF3O2/c1-2-15-3-4(8)5(14)6(9,10)7(11,12)13;1-11-2-3(6)4(10)5(7,8)9/h3H,2H2,1H3;2H,1H3/b4-3-;3-2- |
| InChIKey | KJBIYDXBKLOQMC-DLEFDPBHSA-N |
| XLogP | 4.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.10 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|