About 1-naphthalen-1-yltellanyl-2,3-dihydropyrrole
1-naphthalen-1-yltellanyl-2,3-dihydropyrrole (PubChem CID 88617227) has the molecular formula C14H13NTe
and a molecular weight of 322.87 g/mol. Its IUPAC name is 1-naphthalen-1-yltellanyl-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 1-naphthalen-1-yltellanyl-2,3-dihydropyrrole |
| PubChem CID | 88617227 |
| Molecular Formula | C14H13NTe |
| Molecular Weight | 322.87 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 1-naphthalen-1-yltellanyl-2,3-dihydropyrrole |
| SMILES | C1=CN([Te]c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C14H13NTe/c1-2-8-13-12(6-1)7-5-9-14(13)16-15-10-3-4-11-15/h1-3,5-10H,4,11H2 |
| InChIKey | SFCAUKRVNIDFHV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.87 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-naphthalen-1-yltellanyl-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-naphthalen-1-yltellanyl-2,3-dihydropyrrole?
The IUPAC name of 1-naphthalen-1-yltellanyl-2,3-dihydropyrrole (CID 88617227) is 1-naphthalen-1-yltellanyl-2,3-dihydropyrrole.
What is the SMILES notation for 1-naphthalen-1-yltellanyl-2,3-dihydropyrrole?
The canonical SMILES for 1-naphthalen-1-yltellanyl-2,3-dihydropyrrole is C1=CN([Te]c2cccc3ccccc23)CC1.
What is the InChIKey of 1-naphthalen-1-yltellanyl-2,3-dihydropyrrole?
The InChIKey is SFCAUKRVNIDFHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NTe/c1-2-8-13-12(6-1)7-5-9-14(13)16-15-10-3-4-11-15/h1-3,5-10H,4,11H2.
What are the key properties of 1-naphthalen-1-yltellanyl-2,3-dihydropyrrole?
1-naphthalen-1-yltellanyl-2,3-dihydropyrrole has a molecular weight of 322.87 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-naphthalen-1-yltellanyl-2,3-dihydropyrrole is sourced from PubChem (CID 88617227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).