About 2-pentylbutanediamide
2-pentylbutanediamide (PubChem CID 88617297) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-pentylbutanediamide.
Molecular Properties
| Compound Name | 2-pentylbutanediamide |
| PubChem CID | 88617297 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-pentylbutanediamide |
| SMILES | CCCCCC(CC(N)=O)C(N)=O |
| InChI | InChI=1S/C9H18N2O2/c1-2-3-4-5-7(9(11)13)6-8(10)12/h7H,2-6H2,1H3,(H2,10,12)(H2,11,13) |
| InChIKey | DQOQKYPWIBWCIV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentylbutanediamide?
The IUPAC name of 2-pentylbutanediamide (CID 88617297) is 2-pentylbutanediamide.
What is the SMILES notation for 2-pentylbutanediamide?
The canonical SMILES for 2-pentylbutanediamide is CCCCCC(CC(N)=O)C(N)=O.
What is the InChIKey of 2-pentylbutanediamide?
The InChIKey is DQOQKYPWIBWCIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-2-3-4-5-7(9(11)13)6-8(10)12/h7H,2-6H2,1H3,(H2,10,12)(H2,11,13).
What are the key properties of 2-pentylbutanediamide?
2-pentylbutanediamide has a molecular weight of 186.25 g/mol, XLogP of 0.54, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentylbutanediamide is sourced from PubChem (CID 88617297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).