C20H29N3O4 — CID 8861774
[(2R)-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-yl] 6-(carbamoylamino)hexanoate (PubChem CID 8861774) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-yl] 6-(carbamoylamino)hexanoate.
| Compound Name | [(2R)-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-yl] 6-(carbamoylamino)hexanoate |
|---|---|
| PubChem CID | 8861774 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | [(2R)-1-oxo-1-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propan-2-yl] 6-(carbamoylamino)hexanoate |
| SMILES | C[C@@H](OC(=O)CCCCCNC(N)=O)C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C20H29N3O4/c1-14(27-18(24)12-3-2-6-13-22-20(21)26)19(25)23-17-11-7-9-15-8-4-5-10-16(15)17/h4-5,8,10,14,17H,2-3,6-7,9,11-13H2,1H3,(H,23,25)(H3,21,22,26)/t14-,17-/m1/s1 |
| InChIKey | SNVJIBZVHLZXCC-RHSMWYFYSA-N |
| XLogP | 2.34 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|