C10H16O6P2 — CID 88617789
[2-ethyl-4-(phosphonomethyl)phenyl]methylphosphonic acid (PubChem CID 88617789) has the molecular formula C10H16O6P2 and a molecular weight of 294.18 g/mol. Its IUPAC name is [2-ethyl-4-(phosphonomethyl)phenyl]methylphosphonic acid.
| Compound Name | [2-ethyl-4-(phosphonomethyl)phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 88617789 |
| Molecular Formula | C10H16O6P2 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | [2-ethyl-4-(phosphonomethyl)phenyl]methylphosphonic acid |
| SMILES | CCc1cc(CP(=O)(O)O)ccc1CP(=O)(O)O |
| InChI | InChI=1S/C10H16O6P2/c1-2-9-5-8(6-17(11,12)13)3-4-10(9)7-18(14,15)16/h3-5H,2,6-7H2,1H3,(H2,11,12,13)(H2,14,15,16) |
| InChIKey | SEOWPNBKNYBXQA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|