About copper(1+);4H-imidazole;prop-1-ene
copper(1+);4H-imidazole;prop-1-ene (PubChem CID 88618228) has the molecular formula C6H9CuN2
and a molecular weight of 172.70 g/mol. Its IUPAC name is copper(1+);4H-imidazole;prop-1-ene.
Molecular Properties
| Compound Name | copper(1+);4H-imidazole;prop-1-ene |
| PubChem CID | 88618228 |
| Molecular Formula | C6H9CuN2 |
| Molecular Weight | 172.70 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | copper(1+);4H-imidazole;prop-1-ene |
| SMILES | C1=NC=NC1.C=C[CH2-].[Cu+] |
| InChI | InChI=1S/C3H4N2.C3H5.Cu/c1-2-5-3-4-1;1-3-2;/h1,3H,2H2;3H,1-2H2;/q;-1;+1 |
| InChIKey | FIAUDLJXFGGFAF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.70 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);4H-imidazole;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);4H-imidazole;prop-1-ene?
The IUPAC name of copper(1+);4H-imidazole;prop-1-ene (CID 88618228) is copper(1+);4H-imidazole;prop-1-ene.
What is the SMILES notation for copper(1+);4H-imidazole;prop-1-ene?
The canonical SMILES for copper(1+);4H-imidazole;prop-1-ene is C1=NC=NC1.C=C[CH2-].[Cu+].
What is the InChIKey of copper(1+);4H-imidazole;prop-1-ene?
The InChIKey is FIAUDLJXFGGFAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2.C3H5.Cu/c1-2-5-3-4-1;1-3-2;/h1,3H,2H2;3H,1-2H2;/q;-1;+1.
What are the key properties of copper(1+);4H-imidazole;prop-1-ene?
copper(1+);4H-imidazole;prop-1-ene has a molecular weight of 172.70 g/mol, XLogP of 1.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);4H-imidazole;prop-1-ene is sourced from PubChem (CID 88618228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).