About copper;1,2-dihydroimidazol-2-ide;prop-1-ene
copper;1,2-dihydroimidazol-2-ide;prop-1-ene (PubChem CID 88618229) has the molecular formula C6H8CuN2
and a molecular weight of 171.69 g/mol. Its IUPAC name is copper;1,2-dihydroimidazol-2-ide;prop-1-ene.
Molecular Properties
| Compound Name | copper;1,2-dihydroimidazol-2-ide;prop-1-ene |
| PubChem CID | 88618229 |
| Molecular Formula | C6H8CuN2 |
| Molecular Weight | 171.69 g/mol |
| Exact Mass | 171.00 |
| IUPAC Name | copper;1,2-dihydroimidazol-2-ide;prop-1-ene |
| SMILES | C=C[CH2-].[Cu+2].[c-]1ncc[nH]1 |
| InChI | InChI=1S/C3H3N2.C3H5.Cu/c1-2-5-3-4-1;1-3-2;/h1-2H,(H,4,5);3H,1-2H2;/q2*-1;+2 |
| InChIKey | RZBINVJYDJDDOH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.69 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze copper;1,2-dihydroimidazol-2-ide;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;1,2-dihydroimidazol-2-ide;prop-1-ene?
The IUPAC name of copper;1,2-dihydroimidazol-2-ide;prop-1-ene (CID 88618229) is copper;1,2-dihydroimidazol-2-ide;prop-1-ene.
What is the SMILES notation for copper;1,2-dihydroimidazol-2-ide;prop-1-ene?
The canonical SMILES for copper;1,2-dihydroimidazol-2-ide;prop-1-ene is C=C[CH2-].[Cu+2].[c-]1ncc[nH]1.
What is the InChIKey of copper;1,2-dihydroimidazol-2-ide;prop-1-ene?
The InChIKey is RZBINVJYDJDDOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N2.C3H5.Cu/c1-2-5-3-4-1;1-3-2;/h1-2H,(H,4,5);3H,1-2H2;/q2*-1;+2.
What are the key properties of copper;1,2-dihydroimidazol-2-ide;prop-1-ene?
copper;1,2-dihydroimidazol-2-ide;prop-1-ene has a molecular weight of 171.69 g/mol, XLogP of 1.21, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for copper;1,2-dihydroimidazol-2-ide;prop-1-ene is sourced from PubChem (CID 88618229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).