About 2-phenylethenesulfonate;tris(4-chlorophenyl)-methylphosphanium
2-phenylethenesulfonate;tris(4-chlorophenyl)-methylphosphanium (PubChem CID 88618335) has the molecular formula C27H22Cl3O3PS
and a molecular weight of 563.87 g/mol. Its IUPAC name is 2-phenylethenesulfonate;tris(4-chlorophenyl)-methylphosphanium.
Molecular Properties
| Compound Name | 2-phenylethenesulfonate;tris(4-chlorophenyl)-methylphosphanium |
| PubChem CID | 88618335 |
| Molecular Formula | C27H22Cl3O3PS |
| Molecular Weight | 563.87 g/mol |
| Exact Mass | 562.01 |
| IUPAC Name | 2-phenylethenesulfonate;tris(4-chlorophenyl)-methylphosphanium |
| SMILES | C[P+](c1ccc(Cl)cc1)(c1ccc(Cl)cc1)c1ccc(Cl)cc1.O=S(=O)([O-])C=Cc1ccccc1 |
| InChI | InChI=1S/C19H15Cl3P.C8H8O3S/c1-23(17-8-2-14(20)3-9-17,18-10-4-15(21)5-11-18)19-12-6-16(22)7-13-19;9-12(10,11)7-6-8-4-2-1-3-5-8/h2-13H,1H3;1-7H,(H,9,10,11)/q+1;/p-1 |
| InChIKey | QTHQAOXBYFLJJY-UHFFFAOYSA-M |
| XLogP | 6.77 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 563.87 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethenesulfonate;tris(4-chlorophenyl)-methylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethenesulfonate;tris(4-chlorophenyl)-methylphosphanium?
The IUPAC name of 2-phenylethenesulfonate;tris(4-chlorophenyl)-methylphosphanium (CID 88618335) is 2-phenylethenesulfonate;tris(4-chlorophenyl)-methylphosphanium.
What is the SMILES notation for 2-phenylethenesulfonate;tris(4-chlorophenyl)-methylphosphanium?
The canonical SMILES for 2-phenylethenesulfonate;tris(4-chlorophenyl)-methylphosphanium is C[P+](c1ccc(Cl)cc1)(c1ccc(Cl)cc1)c1ccc(Cl)cc1.O=S(=O)([O-])C=Cc1ccccc1.
What is the InChIKey of 2-phenylethenesulfonate;tris(4-chlorophenyl)-methylphosphanium?
The InChIKey is QTHQAOXBYFLJJY-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H15Cl3P.C8H8O3S/c1-23(17-8-2-14(20)3-9-17,18-10-4-15(21)5-11-18)19-12-6-16(22)7-13-19;9-12(10,11)7-6-8-4-2-1-3-5-8/h2-13H,1H3;1-7H,(H,9,10,11)/q+1;/p-1.
What are the key properties of 2-phenylethenesulfonate;tris(4-chlorophenyl)-methylphosphanium?
2-phenylethenesulfonate;tris(4-chlorophenyl)-methylphosphanium has a molecular weight of 563.87 g/mol, XLogP of 6.77, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethenesulfonate;tris(4-chlorophenyl)-methylphosphanium is sourced from PubChem (CID 88618335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).