About 2-(2-prop-2-enylsulfonyloxyethoxy)ethyl prop-2-ene-1-sulfonate
2-(2-prop-2-enylsulfonyloxyethoxy)ethyl prop-2-ene-1-sulfonate (PubChem CID 88618590) has the molecular formula C10H18O7S2
and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-(2-prop-2-enylsulfonyloxyethoxy)ethyl prop-2-ene-1-sulfonate.
Molecular Properties
| Compound Name | 2-(2-prop-2-enylsulfonyloxyethoxy)ethyl prop-2-ene-1-sulfonate |
| PubChem CID | 88618590 |
| Molecular Formula | C10H18O7S2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-(2-prop-2-enylsulfonyloxyethoxy)ethyl prop-2-ene-1-sulfonate |
| SMILES | C=CCS(=O)(=O)OCCOCCOS(=O)(=O)CC=C |
| InChI | InChI=1S/C10H18O7S2/c1-3-9-18(11,12)16-7-5-15-6-8-17-19(13,14)10-4-2/h3-4H,1-2,5-10H2 |
| InChIKey | GNGXDJXOLDVXNT-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-prop-2-enylsulfonyloxyethoxy)ethyl prop-2-ene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-prop-2-enylsulfonyloxyethoxy)ethyl prop-2-ene-1-sulfonate?
The IUPAC name of 2-(2-prop-2-enylsulfonyloxyethoxy)ethyl prop-2-ene-1-sulfonate (CID 88618590) is 2-(2-prop-2-enylsulfonyloxyethoxy)ethyl prop-2-ene-1-sulfonate.
What is the SMILES notation for 2-(2-prop-2-enylsulfonyloxyethoxy)ethyl prop-2-ene-1-sulfonate?
The canonical SMILES for 2-(2-prop-2-enylsulfonyloxyethoxy)ethyl prop-2-ene-1-sulfonate is C=CCS(=O)(=O)OCCOCCOS(=O)(=O)CC=C.
What is the InChIKey of 2-(2-prop-2-enylsulfonyloxyethoxy)ethyl prop-2-ene-1-sulfonate?
The InChIKey is GNGXDJXOLDVXNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O7S2/c1-3-9-18(11,12)16-7-5-15-6-8-17-19(13,14)10-4-2/h3-4H,1-2,5-10H2.
What are the key properties of 2-(2-prop-2-enylsulfonyloxyethoxy)ethyl prop-2-ene-1-sulfonate?
2-(2-prop-2-enylsulfonyloxyethoxy)ethyl prop-2-ene-1-sulfonate has a molecular weight of 314.38 g/mol, XLogP of 0.07, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-prop-2-enylsulfonyloxyethoxy)ethyl prop-2-ene-1-sulfonate is sourced from PubChem (CID 88618590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).