C21H27NO5S — CID 88618682
methanesulfonic acid;2-methyl-2-[(10-methylanthracen-9-yl)methylamino]propane-1,3-diol (PubChem CID 88618682) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is methanesulfonic acid;2-methyl-2-[(10-methylanthracen-9-yl)methylamino]propane-1,3-diol.
| Compound Name | methanesulfonic acid;2-methyl-2-[(10-methylanthracen-9-yl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 88618682 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | methanesulfonic acid;2-methyl-2-[(10-methylanthracen-9-yl)methylamino]propane-1,3-diol |
| SMILES | CS(=O)(=O)O.Cc1c2ccccc2c(CNC(C)(CO)CO)c2ccccc12 |
| InChI | InChI=1S/C20H23NO2.CH4O3S/c1-14-15-7-3-5-9-17(15)19(11-21-20(2,12-22)13-23)18-10-6-4-8-16(14)18;1-5(2,3)4/h3-10,21-23H,11-13H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | XLNKFUGAXXEVHK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|