About 2-methylpropanedithial
2-methylpropanedithial (PubChem CID 88619350) has the molecular formula C4H6S2
and a molecular weight of 118.23 g/mol. Its IUPAC name is 2-methylpropanedithial.
Molecular Properties
| Compound Name | 2-methylpropanedithial |
| PubChem CID | 88619350 |
| Molecular Formula | C4H6S2 |
| Molecular Weight | 118.23 g/mol |
| Exact Mass | 117.99 |
| IUPAC Name | 2-methylpropanedithial |
| SMILES | CC(C=S)C=S |
| InChI | InChI=1S/C4H6S2/c1-4(2-5)3-6/h2-4H,1H3 |
| InChIKey | ALDBJKLIQVTWMS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanedithial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanedithial?
The IUPAC name of 2-methylpropanedithial (CID 88619350) is 2-methylpropanedithial.
What is the SMILES notation for 2-methylpropanedithial?
The canonical SMILES for 2-methylpropanedithial is CC(C=S)C=S.
What is the InChIKey of 2-methylpropanedithial?
The InChIKey is ALDBJKLIQVTWMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6S2/c1-4(2-5)3-6/h2-4H,1H3.
What are the key properties of 2-methylpropanedithial?
2-methylpropanedithial has a molecular weight of 118.23 g/mol, XLogP of 1.62, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanedithial is sourced from PubChem (CID 88619350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).