C10H15NO4 — CID 88619896
dimethyl (E,4Z)-4-(dimethylaminomethylidene)pent-2-enedioate (PubChem CID 88619896) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is dimethyl (E,4Z)-4-(dimethylaminomethylidene)pent-2-enedioate.
| Compound Name | dimethyl (E,4Z)-4-(dimethylaminomethylidene)pent-2-enedioate |
|---|---|
| PubChem CID | 88619896 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | dimethyl (E,4Z)-4-(dimethylaminomethylidene)pent-2-enedioate |
| SMILES | COC(=O)/C=C/C(=C/N(C)C)C(=O)OC |
| InChI | InChI=1S/C10H15NO4/c1-11(2)7-8(10(13)15-4)5-6-9(12)14-3/h5-7H,1-4H3/b6-5+,8-7- |
| InChIKey | WTNNSNXMGAJEJG-MDAAKZFYSA-N |
| XLogP | 0.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|