C14H18N2O6 — CID 88619906
2,2-bis(hydroxymethyl)propane-1,3-diol;2,4-diisocyanato-1-methylbenzene (PubChem CID 88619906) has the molecular formula C14H18N2O6 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;2,4-diisocyanato-1-methylbenzene.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2,4-diisocyanato-1-methylbenzene |
|---|---|
| PubChem CID | 88619906 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;2,4-diisocyanato-1-methylbenzene |
| SMILES | Cc1ccc(N=C=O)cc1N=C=O.OCC(CO)(CO)CO |
| InChI | InChI=1S/C9H6N2O2.C5H12O4/c1-7-2-3-8(10-5-12)4-9(7)11-6-13;6-1-5(2-7,3-8)4-9/h2-4H,1H3;6-9H,1-4H2 |
| InChIKey | MBUCSPSZEPRLOB-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 139.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|