C10H25NO7P2S — CID 88619977
(1-amino-4-cyclohexylsulfanyl-1-phosphonobutyl)phosphonic acid;hydrate (PubChem CID 88619977) has the molecular formula C10H25NO7P2S and a molecular weight of 365.33 g/mol. Its IUPAC name is (1-amino-4-cyclohexylsulfanyl-1-phosphonobutyl)phosphonic acid;hydrate.
| Compound Name | (1-amino-4-cyclohexylsulfanyl-1-phosphonobutyl)phosphonic acid;hydrate |
|---|---|
| PubChem CID | 88619977 |
| Molecular Formula | C10H25NO7P2S |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | (1-amino-4-cyclohexylsulfanyl-1-phosphonobutyl)phosphonic acid;hydrate |
| SMILES | NC(CCCSC1CCCCC1)(P(=O)(O)O)P(=O)(O)O.O |
| InChI | InChI=1S/C10H23NO6P2S.H2O/c11-10(18(12,13)14,19(15,16)17)7-4-8-20-9-5-2-1-3-6-9;/h9H,1-8,11H2,(H2,12,13,14)(H2,15,16,17);1H2 |
| InChIKey | ZJDSNRWELTWPLP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 172.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|