About 4-(2,4-dichlorophenyl)-2,6-diphenylthiopyrylium perchlorate
4-(2,4-dichlorophenyl)-2,6-diphenylthiopyrylium perchlorate (PubChem CID 88620208) has the molecular formula C23H15Cl3O4S
and a molecular weight of 493.80 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-2,6-diphenylthiopyrylium perchlorate.
Molecular Properties
| Compound Name | 4-(2,4-dichlorophenyl)-2,6-diphenylthiopyrylium perchlorate |
| PubChem CID | 88620208 |
| Molecular Formula | C23H15Cl3O4S |
| Molecular Weight | 493.80 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-2,6-diphenylthiopyrylium perchlorate |
| SMILES | Clc1ccc(-c2cc(-c3ccccc3)[s+]c(-c3ccccc3)c2)c(Cl)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H15Cl2S.ClHO4/c24-19-11-12-20(21(25)15-19)18-13-22(16-7-3-1-4-8-16)26-23(14-18)17-9-5-2-6-10-17;2-1(3,4)5/h1-15H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | NXVYMWMERRXANY-UHFFFAOYSA-M |
| XLogP | 3.58 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.80 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-dichlorophenyl)-2,6-diphenylthiopyrylium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dichlorophenyl)-2,6-diphenylthiopyrylium perchlorate?
The IUPAC name of 4-(2,4-dichlorophenyl)-2,6-diphenylthiopyrylium perchlorate (CID 88620208) is 4-(2,4-dichlorophenyl)-2,6-diphenylthiopyrylium perchlorate.
What is the SMILES notation for 4-(2,4-dichlorophenyl)-2,6-diphenylthiopyrylium perchlorate?
The canonical SMILES for 4-(2,4-dichlorophenyl)-2,6-diphenylthiopyrylium perchlorate is Clc1ccc(-c2cc(-c3ccccc3)[s+]c(-c3ccccc3)c2)c(Cl)c1.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 4-(2,4-dichlorophenyl)-2,6-diphenylthiopyrylium perchlorate?
The InChIKey is NXVYMWMERRXANY-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H15Cl2S.ClHO4/c24-19-11-12-20(21(25)15-19)18-13-22(16-7-3-1-4-8-16)26-23(14-18)17-9-5-2-6-10-17;2-1(3,4)5/h1-15H;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 4-(2,4-dichlorophenyl)-2,6-diphenylthiopyrylium perchlorate?
4-(2,4-dichlorophenyl)-2,6-diphenylthiopyrylium perchlorate has a molecular weight of 493.80 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichlorophenyl)-2,6-diphenylthiopyrylium perchlorate is sourced from PubChem (CID 88620208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).