C20H17Cl5OS — CID 88620660
(E)-1-(2,3,4,5,6-pentachlorophenyl)-3-(4-pentylsulfanylphenyl)prop-2-en-1-one (PubChem CID 88620660) has the molecular formula C20H17Cl5OS and a molecular weight of 482.69 g/mol. Its IUPAC name is (E)-1-(2,3,4,5,6-pentachlorophenyl)-3-(4-pentylsulfanylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,3,4,5,6-pentachlorophenyl)-3-(4-pentylsulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 88620660 |
| Molecular Formula | C20H17Cl5OS |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 479.94 |
| IUPAC Name | (E)-1-(2,3,4,5,6-pentachlorophenyl)-3-(4-pentylsulfanylphenyl)prop-2-en-1-one |
| SMILES | CCCCCSc1ccc(/C=C/C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C20H17Cl5OS/c1-2-3-4-11-27-13-8-5-12(6-9-13)7-10-14(26)15-16(21)18(23)20(25)19(24)17(15)22/h5-10H,2-4,11H2,1H3/b10-7+ |
| InChIKey | BZWVDQBFXWMHHQ-JXMROGBWSA-N |
| XLogP | 9.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|