About 3-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]heptane
3-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]heptane (PubChem CID 88620771) has the molecular formula C17H36O3
and a molecular weight of 288.47 g/mol. Its IUPAC name is 3-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]heptane.
Molecular Properties
| Compound Name | 3-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]heptane |
| PubChem CID | 88620771 |
| Molecular Formula | C17H36O3 |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.27 |
| IUPAC Name | 3-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]heptane |
| SMILES | CCCCC(CC)COC(COC(C)C)COC(C)C |
| InChI | InChI=1S/C17H36O3/c1-7-9-10-16(8-2)11-20-17(12-18-14(3)4)13-19-15(5)6/h14-17H,7-13H2,1-6H3 |
| InChIKey | DREZOTNUUIJZIR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]heptane?
The IUPAC name of 3-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]heptane (CID 88620771) is 3-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]heptane.
What is the SMILES notation for 3-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]heptane?
The canonical SMILES for 3-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]heptane is CCCCC(CC)COC(COC(C)C)COC(C)C.
What is the InChIKey of 3-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]heptane?
The InChIKey is DREZOTNUUIJZIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O3/c1-7-9-10-16(8-2)11-20-17(12-18-14(3)4)13-19-15(5)6/h14-17H,7-13H2,1-6H3.
What are the key properties of 3-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]heptane?
3-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]heptane has a molecular weight of 288.47 g/mol, XLogP of 4.44, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,3-di(propan-2-yloxy)propan-2-yloxymethyl]heptane is sourced from PubChem (CID 88620771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).