C14H15Cl2N3O4 — CID 88620844
2-[4-(4,6-dichloropyrimidin-2-yl)-N-(2,2-dihydroxyethyl)anilino]ethane-1,1-diol (PubChem CID 88620844) has the molecular formula C14H15Cl2N3O4 and a molecular weight of 360.20 g/mol. Its IUPAC name is 2-[4-(4,6-dichloropyrimidin-2-yl)-N-(2,2-dihydroxyethyl)anilino]ethane-1,1-diol.
| Compound Name | 2-[4-(4,6-dichloropyrimidin-2-yl)-N-(2,2-dihydroxyethyl)anilino]ethane-1,1-diol |
|---|---|
| PubChem CID | 88620844 |
| Molecular Formula | C14H15Cl2N3O4 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 2-[4-(4,6-dichloropyrimidin-2-yl)-N-(2,2-dihydroxyethyl)anilino]ethane-1,1-diol |
| SMILES | OC(O)CN(CC(O)O)c1ccc(-c2nc(Cl)cc(Cl)n2)cc1 |
| InChI | InChI=1S/C14H15Cl2N3O4/c15-10-5-11(16)18-14(17-10)8-1-3-9(4-2-8)19(6-12(20)21)7-13(22)23/h1-5,12-13,20-23H,6-7H2 |
| InChIKey | LSVMSNLCWCQEQP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|