C24H34FeO6S2 — CID 88621063
bis(2-hexylbenzenesulfonate);iron(2+) (PubChem CID 88621063) has the molecular formula C24H34FeO6S2 and a molecular weight of 538.51 g/mol. Its IUPAC name is bis(2-hexylbenzenesulfonate);iron(2+).
| Compound Name | bis(2-hexylbenzenesulfonate);iron(2+) |
|---|---|
| PubChem CID | 88621063 |
| Molecular Formula | C24H34FeO6S2 |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | bis(2-hexylbenzenesulfonate);iron(2+) |
| SMILES | CCCCCCc1ccccc1S(=O)(=O)[O-].CCCCCCc1ccccc1S(=O)(=O)[O-].[Fe+2] |
| InChI | InChI=1S/2C12H18O3S.Fe/c2*1-2-3-4-5-8-11-9-6-7-10-12(11)16(13,14)15;/h2*6-7,9-10H,2-5,8H2,1H3,(H,13,14,15);/q;;+2/p-2 |
| InChIKey | UJGDTIILGZGOJB-UHFFFAOYSA-L |
| XLogP | 5.42 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|