About cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid
cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid (PubChem CID 88621074) has the molecular formula C12H27NO4S
and a molecular weight of 281.42 g/mol. Its IUPAC name is cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid.
Molecular Properties
| Compound Name | cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid |
| PubChem CID | 88621074 |
| Molecular Formula | C12H27NO4S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid |
| SMILES | CCN(CC)C[C@H]1CCCC[C@@H]1O.CS(=O)(=O)O |
| InChI | InChI=1S/C11H23NO.CH4O3S/c1-3-12(4-2)9-10-7-5-6-8-11(10)13;1-5(2,3)4/h10-11,13H,3-9H2,1-2H3;1H3,(H,2,3,4)/t10-,11+;/m1./s1 |
| InChIKey | XOCOIZHRSWZUAI-DHXVBOOMSA-N |
| XLogP | 1.38 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid?
The IUPAC name of cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid (CID 88621074) is cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid.
What is the SMILES notation for cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid?
The canonical SMILES for cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid is CCN(CC)C[C@H]1CCCC[C@@H]1O.CS(=O)(=O)O.
What is the InChIKey of cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid?
The InChIKey is XOCOIZHRSWZUAI-DHXVBOOMSA-N. The full InChI is InChI=1S/C11H23NO.CH4O3S/c1-3-12(4-2)9-10-7-5-6-8-11(10)13;1-5(2,3)4/h10-11,13H,3-9H2,1-2H3;1H3,(H,2,3,4)/t10-,11+;/m1./s1.
What are the key properties of cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid?
cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid has a molecular weight of 281.42 g/mol, XLogP of 1.38, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid is sourced from PubChem (CID 88621074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).