C33H45N5O2 — CID 88621114
1-[3,3-bis(benzylamino)-2-hydroxypropyl]-4-(dimethylamino)-N-(2,6-dimethylphenyl)piperidine-4-carboxamide (PubChem CID 88621114) has the molecular formula C33H45N5O2 and a molecular weight of 543.76 g/mol. Its IUPAC name is 1-[3,3-bis(benzylamino)-2-hydroxypropyl]-4-(dimethylamino)-N-(2,6-dimethylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[3,3-bis(benzylamino)-2-hydroxypropyl]-4-(dimethylamino)-N-(2,6-dimethylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 88621114 |
| Molecular Formula | C33H45N5O2 |
| Molecular Weight | 543.76 g/mol |
| Exact Mass | 543.36 |
| IUPAC Name | 1-[3,3-bis(benzylamino)-2-hydroxypropyl]-4-(dimethylamino)-N-(2,6-dimethylphenyl)piperidine-4-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)C1(N(C)C)CCN(CC(O)C(NCc2ccccc2)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C33H45N5O2/c1-25-12-11-13-26(2)30(25)36-32(40)33(37(3)4)18-20-38(21-19-33)24-29(39)31(34-22-27-14-7-5-8-15-27)35-23-28-16-9-6-10-17-28/h5-17,29,31,34-35,39H,18-24H2,1-4H3,(H,36,40) |
| InChIKey | PHWMSBDWOQWNMY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|