About 6-methyl-2-(1,3-thiazol-2-yl)-1,2-benzoselenazole-3-thione
6-methyl-2-(1,3-thiazol-2-yl)-1,2-benzoselenazole-3-thione (PubChem CID 88621155) has the molecular formula C11H8N2S2Se
and a molecular weight of 311.29 g/mol. Its IUPAC name is 6-methyl-2-(1,3-thiazol-2-yl)-1,2-benzoselenazole-3-thione.
Molecular Properties
| Compound Name | 6-methyl-2-(1,3-thiazol-2-yl)-1,2-benzoselenazole-3-thione |
| PubChem CID | 88621155 |
| Molecular Formula | C11H8N2S2Se |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.93 |
| IUPAC Name | 6-methyl-2-(1,3-thiazol-2-yl)-1,2-benzoselenazole-3-thione |
| SMILES | Cc1ccc2c(=S)n(-c3nccs3)[se]c2c1 |
| InChI | InChI=1S/C11H8N2S2Se/c1-7-2-3-8-9(6-7)16-13(10(8)14)11-12-4-5-15-11/h2-6H,1H3 |
| InChIKey | TYNYLJARGGJIFA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2-(1,3-thiazol-2-yl)-1,2-benzoselenazole-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-(1,3-thiazol-2-yl)-1,2-benzoselenazole-3-thione?
The IUPAC name of 6-methyl-2-(1,3-thiazol-2-yl)-1,2-benzoselenazole-3-thione (CID 88621155) is 6-methyl-2-(1,3-thiazol-2-yl)-1,2-benzoselenazole-3-thione.
What is the SMILES notation for 6-methyl-2-(1,3-thiazol-2-yl)-1,2-benzoselenazole-3-thione?
The canonical SMILES for 6-methyl-2-(1,3-thiazol-2-yl)-1,2-benzoselenazole-3-thione is Cc1ccc2c(=S)n(-c3nccs3)[se]c2c1.
What is the InChIKey of 6-methyl-2-(1,3-thiazol-2-yl)-1,2-benzoselenazole-3-thione?
The InChIKey is TYNYLJARGGJIFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2S2Se/c1-7-2-3-8-9(6-7)16-13(10(8)14)11-12-4-5-15-11/h2-6H,1H3.
What are the key properties of 6-methyl-2-(1,3-thiazol-2-yl)-1,2-benzoselenazole-3-thione?
6-methyl-2-(1,3-thiazol-2-yl)-1,2-benzoselenazole-3-thione has a molecular weight of 311.29 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-(1,3-thiazol-2-yl)-1,2-benzoselenazole-3-thione is sourced from PubChem (CID 88621155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).